C20H23N5 — CID 71884718
N-(1-propan-2-ylpyrrolidin-3-yl)-2-pyridin-4-ylquinazolin-4-amine (PubChem CID 71884718) has the molecular formula C20H23N5 and a molecular weight of 333.44 g/mol. Its IUPAC name is N-(1-propan-2-ylpyrrolidin-3-yl)-2-pyridin-4-ylquinazolin-4-amine.
| Compound Name | N-(1-propan-2-ylpyrrolidin-3-yl)-2-pyridin-4-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 71884718 |
| Molecular Formula | C20H23N5 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | N-(1-propan-2-ylpyrrolidin-3-yl)-2-pyridin-4-ylquinazolin-4-amine |
| SMILES | CC(C)N1CCC(Nc2nc(-c3ccncc3)nc3ccccc23)C1 |
| InChI | InChI=1S/C20H23N5/c1-14(2)25-12-9-16(13-25)22-20-17-5-3-4-6-18(17)23-19(24-20)15-7-10-21-11-8-15/h3-8,10-11,14,16H,9,12-13H2,1-2H3,(H,22,23,24) |
| InChIKey | WYGUTZGLMJWNBO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |