C24H21N5O — CID 97016537
[(3S)-3-[(2-phenylquinazolin-4-yl)amino]pyrrolidin-1-yl]-pyridin-2-ylmethanone (PubChem CID 97016537) has the molecular formula C24H21N5O and a molecular weight of 395.47 g/mol. Its IUPAC name is [(3S)-3-[(2-phenylquinazolin-4-yl)amino]pyrrolidin-1-yl]-pyridin-2-ylmethanone.
| Compound Name | [(3S)-3-[(2-phenylquinazolin-4-yl)amino]pyrrolidin-1-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 97016537 |
| Molecular Formula | C24H21N5O |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | [(3S)-3-[(2-phenylquinazolin-4-yl)amino]pyrrolidin-1-yl]-pyridin-2-ylmethanone |
| SMILES | O=C(c1ccccn1)N1CC[C@H](Nc2nc(-c3ccccc3)nc3ccccc23)C1 |
| InChI | InChI=1S/C24H21N5O/c30-24(21-12-6-7-14-25-21)29-15-13-18(16-29)26-23-19-10-4-5-11-20(19)27-22(28-23)17-8-2-1-3-9-17/h1-12,14,18H,13,15-16H2,(H,26,27,28)/t18-/m0/s1 |
| InChIKey | JZUOXJYGHOVSHC-SFHVURJKSA-N |
| XLogP | 4.02 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |