C20H16N6O3 — CID 133404584
6-nitro-2-[[1-(pyridine-2-carbonyl)pyrrolidin-3-yl]amino]quinoline-4-carbonitrile (PubChem CID 133404584) has the molecular formula C20H16N6O3 and a molecular weight of 388.39 g/mol. Its IUPAC name is 6-nitro-2-[[1-(pyridine-2-carbonyl)pyrrolidin-3-yl]amino]quinoline-4-carbonitrile.
| Compound Name | 6-nitro-2-[[1-(pyridine-2-carbonyl)pyrrolidin-3-yl]amino]quinoline-4-carbonitrile |
|---|---|
| PubChem CID | 133404584 |
| Molecular Formula | C20H16N6O3 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 6-nitro-2-[[1-(pyridine-2-carbonyl)pyrrolidin-3-yl]amino]quinoline-4-carbonitrile |
| SMILES | N#Cc1cc(NC2CCN(C(=O)c3ccccn3)C2)nc2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C20H16N6O3/c21-11-13-9-19(24-17-5-4-15(26(28)29)10-16(13)17)23-14-6-8-25(12-14)20(27)18-3-1-2-7-22-18/h1-5,7,9-10,14H,6,8,12H2,(H,23,24) |
| InChIKey | MBLDVUWWCZNEOK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 125.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|