C16H15IN4O3 — CID 133404565
[3-(4-iodo-2-nitroanilino)pyrrolidin-1-yl]-pyridin-2-ylmethanone (PubChem CID 133404565) has the molecular formula C16H15IN4O3 and a molecular weight of 438.23 g/mol. Its IUPAC name is [3-(4-iodo-2-nitroanilino)pyrrolidin-1-yl]-pyridin-2-ylmethanone.
| Compound Name | [3-(4-iodo-2-nitroanilino)pyrrolidin-1-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 133404565 |
| Molecular Formula | C16H15IN4O3 |
| Molecular Weight | 438.23 g/mol |
| Exact Mass | 438.02 |
| IUPAC Name | [3-(4-iodo-2-nitroanilino)pyrrolidin-1-yl]-pyridin-2-ylmethanone |
| SMILES | O=C(c1ccccn1)N1CCC(Nc2ccc(I)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C16H15IN4O3/c17-11-4-5-13(15(9-11)21(23)24)19-12-6-8-20(10-12)16(22)14-3-1-2-7-18-14/h1-5,7,9,12,19H,6,8,10H2 |
| InChIKey | JYHYLATVNRQGBR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.23 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|