C18H18F3N5 — CID 133401455
N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-7-(trifluoromethyl)quinolin-4-amine (PubChem CID 133401455) has the molecular formula C18H18F3N5 and a molecular weight of 361.37 g/mol. Its IUPAC name is N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-7-(trifluoromethyl)quinolin-4-amine.
| Compound Name | N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-7-(trifluoromethyl)quinolin-4-amine |
|---|---|
| PubChem CID | 133401455 |
| Molecular Formula | C18H18F3N5 |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-7-(trifluoromethyl)quinolin-4-amine |
| SMILES | CCc1nc2n(n1)CC(Nc1ccnc3cc(C(F)(F)F)ccc13)CC2 |
| InChI | InChI=1S/C18H18F3N5/c1-2-16-24-17-6-4-12(10-26(17)25-16)23-14-7-8-22-15-9-11(18(19,20)21)3-5-13(14)15/h3,5,7-9,12H,2,4,6,10H2,1H3,(H,22,23) |
| InChIKey | PNVHJOVJNSKWLS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |