C18H17ClF2N6O — CID 133281758
4-chloro-2-(2,4-difluorophenyl)-5-[(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]pyridazin-3-one (PubChem CID 133281758) has the molecular formula C18H17ClF2N6O and a molecular weight of 406.82 g/mol. Its IUPAC name is 4-chloro-2-(2,4-difluorophenyl)-5-[(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]pyridazin-3-one.
| Compound Name | 4-chloro-2-(2,4-difluorophenyl)-5-[(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]pyridazin-3-one |
|---|---|
| PubChem CID | 133281758 |
| Molecular Formula | C18H17ClF2N6O |
| Molecular Weight | 406.82 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 4-chloro-2-(2,4-difluorophenyl)-5-[(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)amino]pyridazin-3-one |
| SMILES | CCc1nc2n(n1)CC(Nc1cnn(-c3ccc(F)cc3F)c(=O)c1Cl)CC2 |
| InChI | InChI=1S/C18H17ClF2N6O/c1-2-15-24-16-6-4-11(9-26(16)25-15)23-13-8-22-27(18(28)17(13)19)14-5-3-10(20)7-12(14)21/h3,5,7-8,11,23H,2,4,6,9H2,1H3 |
| InChIKey | OCVHREZIOZRTKW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.82 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |