C18H22F3N3O — CID 133404980
N-[1-(2-methoxyethyl)piperidin-4-yl]-7-(trifluoromethyl)quinolin-4-amine (PubChem CID 133404980) has the molecular formula C18H22F3N3O and a molecular weight of 353.39 g/mol. Its IUPAC name is N-[1-(2-methoxyethyl)piperidin-4-yl]-7-(trifluoromethyl)quinolin-4-amine.
| Compound Name | N-[1-(2-methoxyethyl)piperidin-4-yl]-7-(trifluoromethyl)quinolin-4-amine |
|---|---|
| PubChem CID | 133404980 |
| Molecular Formula | C18H22F3N3O |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | N-[1-(2-methoxyethyl)piperidin-4-yl]-7-(trifluoromethyl)quinolin-4-amine |
| SMILES | COCCN1CCC(Nc2ccnc3cc(C(F)(F)F)ccc23)CC1 |
| InChI | InChI=1S/C18H22F3N3O/c1-25-11-10-24-8-5-14(6-9-24)23-16-4-7-22-17-12-13(18(19,20)21)2-3-15(16)17/h2-4,7,12,14H,5-6,8-11H2,1H3,(H,22,23) |
| InChIKey | LMJJAPKYQFWKOK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |