C23H34F3N3O — CID 156712157
acetylene;ethane;N-[1-(2-methoxyethyl)piperidin-4-yl]-2-methyl-1-(2,2,2-trifluoroethyl)indol-4-amine (PubChem CID 156712157) has the molecular formula C23H34F3N3O and a molecular weight of 425.54 g/mol. Its IUPAC name is acetylene;ethane;N-[1-(2-methoxyethyl)piperidin-4-yl]-2-methyl-1-(2,2,2-trifluoroethyl)indol-4-amine.
| Compound Name | acetylene;ethane;N-[1-(2-methoxyethyl)piperidin-4-yl]-2-methyl-1-(2,2,2-trifluoroethyl)indol-4-amine |
|---|---|
| PubChem CID | 156712157 |
| Molecular Formula | C23H34F3N3O |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | acetylene;ethane;N-[1-(2-methoxyethyl)piperidin-4-yl]-2-methyl-1-(2,2,2-trifluoroethyl)indol-4-amine |
| SMILES | C#C.CC.COCCN1CCC(Nc2cccc3c2cc(C)n3CC(F)(F)F)CC1 |
| InChI | InChI=1S/C19H26F3N3O.C2H6.C2H2/c1-14-12-16-17(4-3-5-18(16)25(14)13-19(20,21)22)23-15-6-8-24(9-7-15)10-11-26-2;2*1-2/h3-5,12,15,23H,6-11,13H2,1-2H3;1-2H3;1-2H |
| InChIKey | DXILPOOTWRWSGV-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 29.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|