C20H30FN3O2 — CID 156712466
1-[4-[[1-(2-fluoroethyl)-2-methylindol-4-yl]amino]piperidin-1-yl]-3-methoxypropan-2-ol (PubChem CID 156712466) has the molecular formula C20H30FN3O2 and a molecular weight of 363.48 g/mol. Its IUPAC name is 1-[4-[[1-(2-fluoroethyl)-2-methylindol-4-yl]amino]piperidin-1-yl]-3-methoxypropan-2-ol.
| Compound Name | 1-[4-[[1-(2-fluoroethyl)-2-methylindol-4-yl]amino]piperidin-1-yl]-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 156712466 |
| Molecular Formula | C20H30FN3O2 |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 1-[4-[[1-(2-fluoroethyl)-2-methylindol-4-yl]amino]piperidin-1-yl]-3-methoxypropan-2-ol |
| SMILES | COCC(O)CN1CCC(Nc2cccc3c2cc(C)n3CCF)CC1 |
| InChI | InChI=1S/C20H30FN3O2/c1-15-12-18-19(4-3-5-20(18)24(15)11-8-21)22-16-6-9-23(10-7-16)13-17(25)14-26-2/h3-5,12,16-17,22,25H,6-11,13-14H2,1-2H3 |
| InChIKey | BDIZTWOFHCEANA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |