C30H37F3N4O5 — CID 145356290
4-[3-[4-[[1-(2,3-dihydroxypropyl)piperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]-3-methoxybenzaldehyde;methanol (PubChem CID 145356290) has the molecular formula C30H37F3N4O5 and a molecular weight of 590.64 g/mol. Its IUPAC name is 4-[3-[4-[[1-(2,3-dihydroxypropyl)piperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]-3-methoxybenzaldehyde;methanol.
| Compound Name | 4-[3-[4-[[1-(2,3-dihydroxypropyl)piperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]-3-methoxybenzaldehyde;methanol |
|---|---|
| PubChem CID | 145356290 |
| Molecular Formula | C30H37F3N4O5 |
| Molecular Weight | 590.64 g/mol |
| Exact Mass | 590.27 |
| IUPAC Name | 4-[3-[4-[[1-(2,3-dihydroxypropyl)piperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]-3-methoxybenzaldehyde;methanol |
| SMILES | CO.COc1cc(C=O)ccc1NCC#Cc1cc2c(NC3CCN(CC(O)CO)CC3)cccc2n1CC(F)(F)F |
| InChI | InChI=1S/C29H33F3N4O4.CH4O/c1-40-28-14-20(17-37)7-8-26(28)33-11-3-4-22-15-24-25(5-2-6-27(24)36(22)19-29(30,31)32)34-21-9-12-35(13-10-21)16-23(39)18-38;1-2/h2,5-8,14-15,17,21,23,33-34,38-39H,9-13,16,18-19H2,1H3;2H,1H3 |
| InChIKey | RXDBKWKAYQOEKU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.64 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|