C29H32BF3N4O2 — CID 169119485
CID 169119485 (PubChem CID 169119485) has the molecular formula C29H32BF3N4O2 and a molecular weight of 536.41 g/mol.
| Compound Name | CID 169119485 |
|---|---|
| PubChem CID | 169119485 |
| Molecular Formula | C29H32BF3N4O2 |
| Molecular Weight | 536.41 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | — |
| SMILES | [B]C(C)(O)Cc1cc(C=O)ccc1NCC#Cc1cc2c(NC3CCN(C)CC3)cccc2n1CC(F)(F)F |
| InChI | InChI=1S/C29H32BF3N4O2/c1-28(30,39)17-21-15-20(18-38)8-9-25(21)34-12-4-5-23-16-24-26(35-22-10-13-36(2)14-11-22)6-3-7-27(24)37(23)19-29(31,32)33/h3,6-9,15-16,18,22,34-35,39H,10-14,17,19H2,1-2H3 |
| InChIKey | UVAVPCAKQYONNX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 69.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|