C29H34F3N4OP — CID 178034735
N-(1-methylpiperidin-4-yl)-2-[3-[4-[methyl(prop-1-en-2-yl)phosphoryl]anilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine (PubChem CID 178034735) has the molecular formula C29H34F3N4OP and a molecular weight of 542.59 g/mol. Its IUPAC name is N-(1-methylpiperidin-4-yl)-2-[3-[4-[methyl(prop-1-en-2-yl)phosphoryl]anilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine.
| Compound Name | N-(1-methylpiperidin-4-yl)-2-[3-[4-[methyl(prop-1-en-2-yl)phosphoryl]anilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine |
|---|---|
| PubChem CID | 178034735 |
| Molecular Formula | C29H34F3N4OP |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | N-(1-methylpiperidin-4-yl)-2-[3-[4-[methyl(prop-1-en-2-yl)phosphoryl]anilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine |
| SMILES | C=C(C)P(C)(=O)c1ccc(NCC#Cc2cc3c(NC4CCN(C)CC4)cccc3n2CC(F)(F)F)cc1 |
| InChI | InChI=1S/C29H34F3N4OP/c1-21(2)38(4,37)25-12-10-22(11-13-25)33-16-6-7-24-19-26-27(34-23-14-17-35(3)18-15-23)8-5-9-28(26)36(24)20-29(30,31)32/h5,8-13,19,23,33-34H,1,14-18,20H2,2-4H3 |
| InChIKey | PIAGLFHLOHEJHC-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 49.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|