C32H39F3N5OP — CID 178034777
2-[4-[[2-[3-(4-dimethylphosphanylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]-1-pyrrolidin-1-ylethanone (PubChem CID 178034777) has the molecular formula C32H39F3N5OP and a molecular weight of 597.67 g/mol. Its IUPAC name is 2-[4-[[2-[3-(4-dimethylphosphanylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[4-[[2-[3-(4-dimethylphosphanylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 178034777 |
| Molecular Formula | C32H39F3N5OP |
| Molecular Weight | 597.67 g/mol |
| Exact Mass | 597.28 |
| IUPAC Name | 2-[4-[[2-[3-(4-dimethylphosphanylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]-1-pyrrolidin-1-ylethanone |
| SMILES | CP(C)c1ccc(NCC#Cc2cc3c(NC4CCN(CC(=O)N5CCCC5)CC4)cccc3n2CC(F)(F)F)cc1 |
| InChI | InChI=1S/C32H39F3N5OP/c1-42(2)27-12-10-24(11-13-27)36-16-6-7-26-21-28-29(8-5-9-30(28)40(26)23-32(33,34)35)37-25-14-19-38(20-15-25)22-31(41)39-17-3-4-18-39/h5,8-13,21,25,36-37H,3-4,14-20,22-23H2,1-2H3 |
| InChIKey | BGWZSDHRGKBAJZ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 52.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.67 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|