C26H28F3N5O2S — CID 145356218
2-[4-[[2-[3-(4-aminosulfanylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]acetic acid (PubChem CID 145356218) has the molecular formula C26H28F3N5O2S and a molecular weight of 531.60 g/mol. Its IUPAC name is 2-[4-[[2-[3-(4-aminosulfanylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]acetic acid.
| Compound Name | 2-[4-[[2-[3-(4-aminosulfanylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 145356218 |
| Molecular Formula | C26H28F3N5O2S |
| Molecular Weight | 531.60 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | 2-[4-[[2-[3-(4-aminosulfanylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]acetic acid |
| SMILES | NSc1ccc(NCC#Cc2cc3c(NC4CCN(CC(=O)O)CC4)cccc3n2CC(F)(F)F)cc1 |
| InChI | InChI=1S/C26H28F3N5O2S/c27-26(28,29)17-34-20(3-2-12-31-18-6-8-21(37-30)9-7-18)15-22-23(4-1-5-24(22)34)32-19-10-13-33(14-11-19)16-25(35)36/h1,4-9,15,19,31-32H,10-14,16-17,30H2,(H,35,36) |
| InChIKey | JEQUXDDVTPOPPB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 95.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.60 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|