C24H24F3N5O3S — CID 130338411
5-[3-[4-[(1,1-dioxothian-4-yl)amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]pyridine-2-carboxamide (PubChem CID 130338411) has the molecular formula C24H24F3N5O3S and a molecular weight of 519.55 g/mol. Its IUPAC name is 5-[3-[4-[(1,1-dioxothian-4-yl)amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]pyridine-2-carboxamide.
| Compound Name | 5-[3-[4-[(1,1-dioxothian-4-yl)amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 130338411 |
| Molecular Formula | C24H24F3N5O3S |
| Molecular Weight | 519.55 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | 5-[3-[4-[(1,1-dioxothian-4-yl)amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]pyridine-2-carboxamide |
| SMILES | NC(=O)c1ccc(NCC#Cc2cc3c(NC4CCS(=O)(=O)CC4)cccc3n2CC(F)(F)F)cn1 |
| InChI | InChI=1S/C24H24F3N5O3S/c25-24(26,27)15-32-18(3-2-10-29-17-6-7-21(23(28)33)30-14-17)13-19-20(4-1-5-22(19)32)31-16-8-11-36(34,35)12-9-16/h1,4-7,13-14,16,29,31H,8-12,15H2,(H2,28,33) |
| InChIKey | KVGGLSJQIARLPS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.55 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|