C28H32F3N3O6S2 — CID 130338413
N-(1,1-dioxothian-4-yl)-2-[3-[2-(2-methoxyethoxy)-4-methylsulfonylanilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine (PubChem CID 130338413) has the molecular formula C28H32F3N3O6S2 and a molecular weight of 627.71 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-2-[3-[2-(2-methoxyethoxy)-4-methylsulfonylanilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine.
| Compound Name | N-(1,1-dioxothian-4-yl)-2-[3-[2-(2-methoxyethoxy)-4-methylsulfonylanilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine |
|---|---|
| PubChem CID | 130338413 |
| Molecular Formula | C28H32F3N3O6S2 |
| Molecular Weight | 627.71 g/mol |
| Exact Mass | 627.17 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-2-[3-[2-(2-methoxyethoxy)-4-methylsulfonylanilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine |
| SMILES | COCCOc1cc(S(C)(=O)=O)ccc1NCC#Cc1cc2c(NC3CCS(=O)(=O)CC3)cccc2n1CC(F)(F)F |
| InChI | InChI=1S/C28H32F3N3O6S2/c1-39-13-14-40-27-18-22(41(2,35)36)8-9-25(27)32-12-4-5-21-17-23-24(33-20-10-15-42(37,38)16-11-20)6-3-7-26(23)34(21)19-28(29,30)31/h3,6-9,17-18,20,32-33H,10-16,19H2,1-2H3 |
| InChIKey | FFDNZYUAYNKOJZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.71 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|