About CID 169119506
CID 169119506 (PubChem CID 169119506) has the molecular formula C27H28B3F3N4O3S
and a molecular weight of 578.04 g/mol.
Molecular Properties
| Compound Name | CID 169119506 |
| PubChem CID | 169119506 |
| Molecular Formula | C27H28B3F3N4O3S |
| Molecular Weight | 578.04 g/mol |
| Exact Mass | 578.21 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])N1CCC(Nc2cccc3c2cc(C#CCNc2ccc(S(C)(=O)=O)cc2OC)n3CC(F)(F)F)CC1 |
| InChI | InChI=1S/C27H28B3F3N4O3S/c1-40-25-16-20(41(2,38)39)8-9-23(25)34-12-4-5-19-15-21-22(6-3-7-24(21)37(19)17-26(31,32)33)35-18-10-13-36(14-11-18)27(28,29)30/h3,6-9,15-16,18,34-35H,10-14,17H2,1-2H3 |
| InChIKey | JEHXOBLAEUMZJM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 578.04 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 169119506 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 169119506?
The IUPAC name of CID 169119506 (CID 169119506) is not available.
What is the SMILES notation for CID 169119506?
The canonical SMILES for CID 169119506 is [B]C([B])([B])N1CCC(Nc2cccc3c2cc(C#CCNc2ccc(S(C)(=O)=O)cc2OC)n3CC(F)(F)F)CC1.
What is the InChIKey of CID 169119506?
The InChIKey is JEHXOBLAEUMZJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H28B3F3N4O3S/c1-40-25-16-20(41(2,38)39)8-9-23(25)34-12-4-5-19-15-21-22(6-3-7-24(21)37(19)17-26(31,32)33)35-18-10-13-36(14-11-18)27(28,29)30/h3,6-9,15-16,18,34-35H,10-14,17H2,1-2H3.
What are the key properties of CID 169119506?
CID 169119506 has a molecular weight of 578.04 g/mol, XLogP of 3.07, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 169119506 is sourced from PubChem (CID 169119506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).