C27H28B3F3N4O3S — CID 169119506
CID 169119506 (PubChem CID 169119506) has the molecular formula C27H28B3F3N4O3S and a molecular weight of 578.04 g/mol.
| Compound Name | CID 169119506 |
|---|---|
| PubChem CID | 169119506 |
| Molecular Formula | C27H28B3F3N4O3S |
| Molecular Weight | 578.04 g/mol |
| Exact Mass | 578.21 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])N1CCC(Nc2cccc3c2cc(C#CCNc2ccc(S(C)(=O)=O)cc2OC)n3CC(F)(F)F)CC1 |
| InChI | InChI=1S/C27H28B3F3N4O3S/c1-40-25-16-20(41(2,38)39)8-9-23(25)34-12-4-5-19-15-21-22(6-3-7-24(21)37(19)17-26(31,32)33)35-18-10-13-36(14-11-18)27(28,29)30/h3,6-9,15-16,18,34-35H,10-14,17H2,1-2H3 |
| InChIKey | JEHXOBLAEUMZJM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.04 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|