C26H29F3N4O3S — CID 165372873
2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-N-[(3R)-piperidin-3-yl]-1-(2,2,2-trifluoroethyl)indol-4-amine (PubChem CID 165372873) has the molecular formula C26H29F3N4O3S and a molecular weight of 534.60 g/mol. Its IUPAC name is 2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-N-[(3R)-piperidin-3-yl]-1-(2,2,2-trifluoroethyl)indol-4-amine.
| Compound Name | 2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-N-[(3R)-piperidin-3-yl]-1-(2,2,2-trifluoroethyl)indol-4-amine |
|---|---|
| PubChem CID | 165372873 |
| Molecular Formula | C26H29F3N4O3S |
| Molecular Weight | 534.60 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | 2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-N-[(3R)-piperidin-3-yl]-1-(2,2,2-trifluoroethyl)indol-4-amine |
| SMILES | COc1cc(S(C)(=O)=O)ccc1NCC#Cc1cc2c(N[C@@H]3CCCNC3)cccc2n1CC(F)(F)F |
| InChI | InChI=1S/C26H29F3N4O3S/c1-36-25-15-20(37(2,34)35)10-11-23(25)31-13-5-7-19-14-21-22(32-18-6-4-12-30-16-18)8-3-9-24(21)33(19)17-26(27,28)29/h3,8-11,14-15,18,30-32H,4,6,12-13,16-17H2,1-2H3/t18-/m1/s1 |
| InChIKey | KMHYMVPZYQQUQP-GOSISDBHSA-N |
| XLogP | 4.24 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.60 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|