C27H30F4N4O3S — CID 165372998
(1R,2S,4S)-2-fluoro-1-N-[2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]cyclohexane-1,4-diamine (PubChem CID 165372998) has the molecular formula C27H30F4N4O3S and a molecular weight of 566.62 g/mol. Its IUPAC name is (1R,2S,4S)-2-fluoro-1-N-[2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]cyclohexane-1,4-diamine.
| Compound Name | (1R,2S,4S)-2-fluoro-1-N-[2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 165372998 |
| Molecular Formula | C27H30F4N4O3S |
| Molecular Weight | 566.62 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | (1R,2S,4S)-2-fluoro-1-N-[2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]cyclohexane-1,4-diamine |
| SMILES | COc1cc(S(C)(=O)=O)ccc1NCC#Cc1cc2c(N[C@@H]3CC[C@H](N)C[C@@H]3F)cccc2n1CC(F)(F)F |
| InChI | InChI=1S/C27H30F4N4O3S/c1-38-26-15-19(39(2,36)37)9-11-24(26)33-12-4-5-18-14-20-22(34-23-10-8-17(32)13-21(23)28)6-3-7-25(20)35(18)16-27(29,30)31/h3,6-7,9,11,14-15,17,21,23,33-34H,8,10,12-13,16,32H2,1-2H3/t17-,21-,23+/m0/s1 |
| InChIKey | RPGGWTAAFBRVCY-JWNTYJGQSA-N |
| XLogP | 4.71 |
| TPSA | 98.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.62 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|