C29H33F4N3O2S — CID 167681451
N-[(1R,2R,4S)-2-fluoro-4-methylcyclohexyl]-2-[3-[2-methoxy-4-(methyl-methylidene-oxo-λ6-sulfanyl)anilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine (PubChem CID 167681451) has the molecular formula C29H33F4N3O2S and a molecular weight of 563.66 g/mol. Its IUPAC name is N-[(1R,2R,4S)-2-fluoro-4-methylcyclohexyl]-2-[3-[2-methoxy-4-(methyl-methylidene-oxo-λ6-sulfanyl)anilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine.
| Compound Name | N-[(1R,2R,4S)-2-fluoro-4-methylcyclohexyl]-2-[3-[2-methoxy-4-(methyl-methylidene-oxo-λ6-sulfanyl)anilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine |
|---|---|
| PubChem CID | 167681451 |
| Molecular Formula | C29H33F4N3O2S |
| Molecular Weight | 563.66 g/mol |
| Exact Mass | 563.22 |
| IUPAC Name | N-[(1R,2R,4S)-2-fluoro-4-methylcyclohexyl]-2-[3-[2-methoxy-4-(methyl-methylidene-oxo-λ6-sulfanyl)anilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine |
| SMILES | C=S(C)(=O)c1ccc(NCC#Cc2cc3c(N[C@@H]4CC[C@H](C)C[C@H]4F)cccc3n2CC(F)(F)F)c(OC)c1 |
| InChI | InChI=1S/C29H33F4N3O2S/c1-19-10-12-25(23(30)15-19)35-24-8-5-9-27-22(24)16-20(36(27)18-29(31,32)33)7-6-14-34-26-13-11-21(39(3,4)37)17-28(26)38-2/h5,8-9,11,13,16-17,19,23,25,34-35H,3,10,12,14-15,18H2,1-2,4H3/t19-,23+,25+,39?/m0/s1 |
| InChIKey | VPGNOGGEKHWDKR-QRGRNIJUSA-N |
| XLogP | 6.32 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.66 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|