C27H31F4N5O5S — CID 169238268
[4-[[2-[3-[4-(amino-methylidene-oxo-λ6-sulfanyl)-2-methoxyanilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]-3-fluoropiperidin-1-yl]methanetriol (PubChem CID 169238268) has the molecular formula C27H31F4N5O5S and a molecular weight of 613.63 g/mol. Its IUPAC name is [4-[[2-[3-[4-(amino-methylidene-oxo-λ6-sulfanyl)-2-methoxyanilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]-3-fluoropiperidin-1-yl]methanetriol.
| Compound Name | [4-[[2-[3-[4-(amino-methylidene-oxo-λ6-sulfanyl)-2-methoxyanilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]-3-fluoropiperidin-1-yl]methanetriol |
|---|---|
| PubChem CID | 169238268 |
| Molecular Formula | C27H31F4N5O5S |
| Molecular Weight | 613.63 g/mol |
| Exact Mass | 613.20 |
| IUPAC Name | [4-[[2-[3-[4-(amino-methylidene-oxo-λ6-sulfanyl)-2-methoxyanilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]-3-fluoropiperidin-1-yl]methanetriol |
| SMILES | C=S(N)(=O)c1ccc(NCC#Cc2cc3c(NC4CCN(C(O)(O)O)CC4F)cccc3n2CC(F)(F)F)c(OC)c1 |
| InChI | InChI=1S/C27H31F4N5O5S/c1-41-25-14-18(42(2,32)40)8-9-23(25)33-11-4-5-17-13-19-21(6-3-7-24(19)36(17)16-26(29,30)31)34-22-10-12-35(15-20(22)28)27(37,38)39/h3,6-9,13-14,20,22,33-34,37-39H,2,10-12,15-16H2,1H3,(H2,32,40) |
| InChIKey | XEBLITGWMPAEAA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 145.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.63 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|