C28H33F4N4O2P — CID 170237372
2-[3-(4-dimethylphosphoryl-2-methoxyanilino)prop-1-ynyl]-N-[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]-1-(2,2,2-trifluoroethyl)indol-4-amine (PubChem CID 170237372) has the molecular formula C28H33F4N4O2P and a molecular weight of 564.56 g/mol. Its IUPAC name is 2-[3-(4-dimethylphosphoryl-2-methoxyanilino)prop-1-ynyl]-N-[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]-1-(2,2,2-trifluoroethyl)indol-4-amine.
| Compound Name | 2-[3-(4-dimethylphosphoryl-2-methoxyanilino)prop-1-ynyl]-N-[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]-1-(2,2,2-trifluoroethyl)indol-4-amine |
|---|---|
| PubChem CID | 170237372 |
| Molecular Formula | C28H33F4N4O2P |
| Molecular Weight | 564.56 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | 2-[3-(4-dimethylphosphoryl-2-methoxyanilino)prop-1-ynyl]-N-[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]-1-(2,2,2-trifluoroethyl)indol-4-amine |
| SMILES | COc1cc(P(C)(C)=O)ccc1NCC#Cc1cc2c(N[C@@H]3CCN(C)C[C@@H]3F)cccc2n1CC(F)(F)F |
| InChI | InChI=1S/C28H33F4N4O2P/c1-35-14-12-24(22(29)17-35)34-23-8-5-9-26-21(23)15-19(36(26)18-28(30,31)32)7-6-13-33-25-11-10-20(39(3,4)37)16-27(25)38-2/h5,8-11,15-16,22,24,33-34H,12-14,17-18H2,1-4H3/t22-,24+/m0/s1 |
| InChIKey | LONYMAZQSKNRQI-LADGPHEKSA-N |
| XLogP | 5.38 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.56 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|