C28H33F4N4O5P — CID 169119511
[5-dimethylphosphoryl-2-[3-[4-[(3-fluoro-1-methylpiperidin-4-yl)amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]phenoxy]methanetriol (PubChem CID 169119511) has the molecular formula C28H33F4N4O5P and a molecular weight of 612.56 g/mol. Its IUPAC name is [5-dimethylphosphoryl-2-[3-[4-[(3-fluoro-1-methylpiperidin-4-yl)amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]phenoxy]methanetriol.
| Compound Name | [5-dimethylphosphoryl-2-[3-[4-[(3-fluoro-1-methylpiperidin-4-yl)amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]phenoxy]methanetriol |
|---|---|
| PubChem CID | 169119511 |
| Molecular Formula | C28H33F4N4O5P |
| Molecular Weight | 612.56 g/mol |
| Exact Mass | 612.21 |
| IUPAC Name | [5-dimethylphosphoryl-2-[3-[4-[(3-fluoro-1-methylpiperidin-4-yl)amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]phenoxy]methanetriol |
| SMILES | CN1CCC(Nc2cccc3c2cc(C#CCNc2ccc(P(C)(C)=O)cc2OC(O)(O)O)n3CC(F)(F)F)C(F)C1 |
| InChI | InChI=1S/C28H33F4N4O5P/c1-35-13-11-23(21(29)16-35)34-22-7-4-8-25-20(22)14-18(36(25)17-27(30,31)32)6-5-12-33-24-10-9-19(42(2,3)40)15-26(24)41-28(37,38)39/h4,7-10,14-15,21,23,33-34,37-39H,11-13,16-17H2,1-3H3 |
| InChIKey | XTAPYSKSWZHYJI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.56 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|