C19H21F4N3 — CID 175294908
N-[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]-2-prop-1-ynyl-1-(2,2,2-trifluoroethyl)indol-4-amine (PubChem CID 175294908) has the molecular formula C19H21F4N3 and a molecular weight of 367.39 g/mol. Its IUPAC name is N-[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]-2-prop-1-ynyl-1-(2,2,2-trifluoroethyl)indol-4-amine.
| Compound Name | N-[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]-2-prop-1-ynyl-1-(2,2,2-trifluoroethyl)indol-4-amine |
|---|---|
| PubChem CID | 175294908 |
| Molecular Formula | C19H21F4N3 |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | N-[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]-2-prop-1-ynyl-1-(2,2,2-trifluoroethyl)indol-4-amine |
| SMILES | CC#Cc1cc2c(N[C@@H]3CCN(C)C[C@@H]3F)cccc2n1CC(F)(F)F |
| InChI | InChI=1S/C19H21F4N3/c1-3-5-13-10-14-16(24-17-8-9-25(2)11-15(17)20)6-4-7-18(14)26(13)12-19(21,22)23/h4,6-7,10,15,17,24H,8-9,11-12H2,1-2H3/t15-,17+/m0/s1 |
| InChIKey | WXSBIFFSAJBBOQ-DOTOQJQBSA-N |
| XLogP | 4.03 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|