C17H21F4N5O — CID 157048025
4-[(3-fluoro-1-methylpiperidin-4-yl)amino]-1-(2,2,2-trifluoroethyl)indole-2-carbohydrazide (PubChem CID 157048025) has the molecular formula C17H21F4N5O and a molecular weight of 387.38 g/mol. Its IUPAC name is 4-[(3-fluoro-1-methylpiperidin-4-yl)amino]-1-(2,2,2-trifluoroethyl)indole-2-carbohydrazide.
| Compound Name | 4-[(3-fluoro-1-methylpiperidin-4-yl)amino]-1-(2,2,2-trifluoroethyl)indole-2-carbohydrazide |
|---|---|
| PubChem CID | 157048025 |
| Molecular Formula | C17H21F4N5O |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 4-[(3-fluoro-1-methylpiperidin-4-yl)amino]-1-(2,2,2-trifluoroethyl)indole-2-carbohydrazide |
| SMILES | CN1CCC(Nc2cccc3c2cc(C(=O)NN)n3CC(F)(F)F)C(F)C1 |
| InChI | InChI=1S/C17H21F4N5O/c1-25-6-5-13(11(18)8-25)23-12-3-2-4-14-10(12)7-15(16(27)24-22)26(14)9-17(19,20)21/h2-4,7,11,13,23H,5-6,8-9,22H2,1H3,(H,24,27) |
| InChIKey | NPGFZVXBVHAYIM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 75.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|