C21H24F4N6O2S — CID 157047216
[5-[4-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,3,4-thiadiazol-2-yl]methyl N-methylcarbamate (PubChem CID 157047216) has the molecular formula C21H24F4N6O2S and a molecular weight of 500.52 g/mol. Its IUPAC name is [5-[4-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,3,4-thiadiazol-2-yl]methyl N-methylcarbamate.
| Compound Name | [5-[4-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,3,4-thiadiazol-2-yl]methyl N-methylcarbamate |
|---|---|
| PubChem CID | 157047216 |
| Molecular Formula | C21H24F4N6O2S |
| Molecular Weight | 500.52 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | [5-[4-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,3,4-thiadiazol-2-yl]methyl N-methylcarbamate |
| SMILES | CNC(=O)OCc1nnc(-c2cc3c(N[C@@H]4CCN(C)C[C@@H]4F)cccc3n2CC(F)(F)F)s1 |
| InChI | InChI=1S/C21H24F4N6O2S/c1-26-20(32)33-10-18-28-29-19(34-18)17-8-12-14(27-15-6-7-30(2)9-13(15)22)4-3-5-16(12)31(17)11-21(23,24)25/h3-5,8,13,15,27H,6-7,9-11H2,1-2H3,(H,26,32)/t13-,15+/m0/s1 |
| InChIKey | XZMRDLDTHBIUQN-DZGCQCFKSA-N |
| XLogP | 4.03 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |