C28H30F4N6O2S — CID 166562355
benzyl N-[[5-[4-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,3,4-thiadiazol-2-yl]methyl]-N-methylcarbamate (PubChem CID 166562355) has the molecular formula C28H30F4N6O2S and a molecular weight of 590.65 g/mol. Its IUPAC name is benzyl N-[[5-[4-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,3,4-thiadiazol-2-yl]methyl]-N-methylcarbamate.
| Compound Name | benzyl N-[[5-[4-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,3,4-thiadiazol-2-yl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 166562355 |
| Molecular Formula | C28H30F4N6O2S |
| Molecular Weight | 590.65 g/mol |
| Exact Mass | 590.21 |
| IUPAC Name | benzyl N-[[5-[4-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,3,4-thiadiazol-2-yl]methyl]-N-methylcarbamate |
| SMILES | CN1CC[C@@H](Nc2cccc3c2cc(-c2nnc(CN(C)C(=O)OCc4ccccc4)s2)n3CC(F)(F)F)[C@@H](F)C1 |
| InChI | InChI=1S/C28H30F4N6O2S/c1-36-12-11-22(20(29)14-36)33-21-9-6-10-23-19(21)13-24(38(23)17-28(30,31)32)26-35-34-25(41-26)15-37(2)27(39)40-16-18-7-4-3-5-8-18/h3-10,13,20,22,33H,11-12,14-17H2,1-2H3/t20-,22+/m0/s1 |
| InChIKey | DWANSGQLKJUNTF-RBBKRZOGSA-N |
| XLogP | 5.94 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.65 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |