C26H33F4N7OS — CID 157048298
N-[[5-[4-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,3,4-thiadiazol-2-yl]methyl]-1-methylpiperidine-4-carboxamide (PubChem CID 157048298) has the molecular formula C26H33F4N7OS and a molecular weight of 567.66 g/mol. Its IUPAC name is N-[[5-[4-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,3,4-thiadiazol-2-yl]methyl]-1-methylpiperidine-4-carboxamide.
| Compound Name | N-[[5-[4-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,3,4-thiadiazol-2-yl]methyl]-1-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 157048298 |
| Molecular Formula | C26H33F4N7OS |
| Molecular Weight | 567.66 g/mol |
| Exact Mass | 567.24 |
| IUPAC Name | N-[[5-[4-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,3,4-thiadiazol-2-yl]methyl]-1-methylpiperidine-4-carboxamide |
| SMILES | CN1CCC(C(=O)NCc2nnc(-c3cc4c(N[C@@H]5CCN(C)C[C@@H]5F)cccc4n3CC(F)(F)F)s2)CC1 |
| InChI | InChI=1S/C26H33F4N7OS/c1-35-9-6-16(7-10-35)24(38)31-13-23-33-34-25(39-23)22-12-17-19(32-20-8-11-36(2)14-18(20)27)4-3-5-21(17)37(22)15-26(28,29)30/h3-5,12,16,18,20,32H,6-11,13-15H2,1-2H3,(H,31,38)/t18-,20+/m0/s1 |
| InChIKey | NAAVJIVXQNJOGQ-AZUAARDMSA-N |
| XLogP | 4.13 |
| TPSA | 78.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.66 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |