C24H23ClF4N6O2S — CID 157047830
5-chloro-N-[[3-[4-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]thiophene-3-carboxamide (PubChem CID 157047830) has the molecular formula C24H23ClF4N6O2S and a molecular weight of 571.00 g/mol. Its IUPAC name is 5-chloro-N-[[3-[4-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]thiophene-3-carboxamide.
| Compound Name | 5-chloro-N-[[3-[4-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 157047830 |
| Molecular Formula | C24H23ClF4N6O2S |
| Molecular Weight | 571.00 g/mol |
| Exact Mass | 570.12 |
| IUPAC Name | 5-chloro-N-[[3-[4-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]thiophene-3-carboxamide |
| SMILES | CN1CC[C@@H](Nc2cccc3c2cc(-c2noc(CNC(=O)c4csc(Cl)c4)n2)n3CC(F)(F)F)[C@@H](F)C1 |
| InChI | InChI=1S/C24H23ClF4N6O2S/c1-34-6-5-17(15(26)10-34)31-16-3-2-4-18-14(16)8-19(35(18)12-24(27,28)29)22-32-21(37-33-22)9-30-23(36)13-7-20(25)38-11-13/h2-4,7-8,11,15,17,31H,5-6,9-10,12H2,1H3,(H,30,36)/t15-,17+/m0/s1 |
| InChIKey | AFCVWSLGAKDZGH-DOTOQJQBSA-N |
| XLogP | 5.35 |
| TPSA | 88.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.00 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |