C23H23F4N7O2S — CID 167524938
N-[[3-[4-[[(3R,4S)-3-fluoro-1-methylpiperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]-1,3-thiazole-5-carboxamide (PubChem CID 167524938) has the molecular formula C23H23F4N7O2S and a molecular weight of 537.54 g/mol. Its IUPAC name is N-[[3-[4-[[(3R,4S)-3-fluoro-1-methylpiperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[[3-[4-[[(3R,4S)-3-fluoro-1-methylpiperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 167524938 |
| Molecular Formula | C23H23F4N7O2S |
| Molecular Weight | 537.54 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | N-[[3-[4-[[(3R,4S)-3-fluoro-1-methylpiperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]-1,3-thiazole-5-carboxamide |
| SMILES | CN1CC[C@H](Nc2cccc3c2cc(-c2noc(CNC(=O)c4cncs4)n2)n3CC(F)(F)F)[C@H](F)C1 |
| InChI | InChI=1S/C23H23F4N7O2S/c1-33-6-5-16(14(24)10-33)30-15-3-2-4-17-13(15)7-18(34(17)11-23(25,26)27)21-31-20(36-32-21)9-29-22(35)19-8-28-12-37-19/h2-4,7-8,12,14,16,30H,5-6,9-11H2,1H3,(H,29,35)/t14-,16+/m1/s1 |
| InChIKey | UFFPAMQTXGTUGV-ZBFHGGJFSA-N |
| XLogP | 4.09 |
| TPSA | 101.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |