C29H32F5N7O2 — CID 157047770
1-(3-fluorocyclopentyl)-N-[[3-[4-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]pyrrole-3-carboxamide (PubChem CID 157047770) has the molecular formula C29H32F5N7O2 and a molecular weight of 605.61 g/mol. Its IUPAC name is 1-(3-fluorocyclopentyl)-N-[[3-[4-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]pyrrole-3-carboxamide.
| Compound Name | 1-(3-fluorocyclopentyl)-N-[[3-[4-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 157047770 |
| Molecular Formula | C29H32F5N7O2 |
| Molecular Weight | 605.61 g/mol |
| Exact Mass | 605.25 |
| IUPAC Name | 1-(3-fluorocyclopentyl)-N-[[3-[4-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]pyrrole-3-carboxamide |
| SMILES | CN1CC[C@@H](Nc2cccc3c2cc(-c2noc(CNC(=O)c4ccn(C5CCC(F)C5)c4)n2)n3CC(F)(F)F)[C@@H](F)C1 |
| InChI | InChI=1S/C29H32F5N7O2/c1-39-9-8-23(21(31)15-39)36-22-3-2-4-24-20(22)12-25(41(24)16-29(32,33)34)27-37-26(43-38-27)13-35-28(42)17-7-10-40(14-17)19-6-5-18(30)11-19/h2-4,7,10,12,14,18-19,21,23,36H,5-6,8-9,11,13,15-16H2,1H3,(H,35,42)/t18?,19?,21-,23+/m0/s1 |
| InChIKey | QCOKHIHTALCSIP-XTRIYOEBSA-N |
| XLogP | 5.50 |
| TPSA | 93.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.61 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |