C23H25F5N6OS — CID 157047195
2,2-difluoro-N-[[5-[4-[(1-methylpiperidin-4-yl)amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,3,4-thiadiazol-2-yl]methyl]cyclopropane-1-carboxamide (PubChem CID 157047195) has the molecular formula C23H25F5N6OS and a molecular weight of 528.55 g/mol. Its IUPAC name is 2,2-difluoro-N-[[5-[4-[(1-methylpiperidin-4-yl)amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,3,4-thiadiazol-2-yl]methyl]cyclopropane-1-carboxamide.
| Compound Name | 2,2-difluoro-N-[[5-[4-[(1-methylpiperidin-4-yl)amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,3,4-thiadiazol-2-yl]methyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 157047195 |
| Molecular Formula | C23H25F5N6OS |
| Molecular Weight | 528.55 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | 2,2-difluoro-N-[[5-[4-[(1-methylpiperidin-4-yl)amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,3,4-thiadiazol-2-yl]methyl]cyclopropane-1-carboxamide |
| SMILES | CN1CCC(Nc2cccc3c2cc(-c2nnc(CNC(=O)C4CC4(F)F)s2)n3CC(F)(F)F)CC1 |
| InChI | InChI=1S/C23H25F5N6OS/c1-33-7-5-13(6-8-33)30-16-3-2-4-17-14(16)9-18(34(17)12-23(26,27)28)21-32-31-19(36-21)11-29-20(35)15-10-22(15,24)25/h2-4,9,13,15,30H,5-8,10-12H2,1H3,(H,29,35) |
| InChIKey | HMZWMLLIAMHXCC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.55 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |