C24H29F3N6O2 — CID 166562320
trans-(1R,2R)-2-methyl-N-[[3-[4-[(1-methylpiperidin-4-yl)amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]cyclopropane-1-carboxamide (PubChem CID 166562320) has the molecular formula C24H29F3N6O2 and a molecular weight of 490.53 g/mol. Its IUPAC name is trans-(1R,2R)-2-methyl-N-[[3-[4-[(1-methylpiperidin-4-yl)amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]cyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-2-methyl-N-[[3-[4-[(1-methylpiperidin-4-yl)amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 166562320 |
| Molecular Formula | C24H29F3N6O2 |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | trans-(1R,2R)-2-methyl-N-[[3-[4-[(1-methylpiperidin-4-yl)amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]-1,2,4-oxadiazol-5-yl]methyl]cyclopropane-1-carboxamide |
| SMILES | C[C@@H]1C[C@H]1C(=O)NCc1nc(-c2cc3c(NC4CCN(C)CC4)cccc3n2CC(F)(F)F)no1 |
| InChI | InChI=1S/C24H29F3N6O2/c1-14-10-16(14)23(34)28-12-21-30-22(31-35-21)20-11-17-18(29-15-6-8-32(2)9-7-15)4-3-5-19(17)33(20)13-24(25,26)27/h3-5,11,14-16,29H,6-10,12-13H2,1-2H3,(H,28,34)/t14-,16-/m1/s1 |
| InChIKey | SUGUQNMBSVNELW-GDBMZVCRSA-N |
| XLogP | 4.03 |
| TPSA | 88.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |