C20H31F4N5O — CID 157047401
4-N-(3-fluoro-1-methylpiperidin-4-yl)-1-(2,2,2-trifluoroethyl)indole-2,4-diamine;formamide;propane (PubChem CID 157047401) has the molecular formula C20H31F4N5O and a molecular weight of 433.49 g/mol. Its IUPAC name is 4-N-(3-fluoro-1-methylpiperidin-4-yl)-1-(2,2,2-trifluoroethyl)indole-2,4-diamine;formamide;propane.
| Compound Name | 4-N-(3-fluoro-1-methylpiperidin-4-yl)-1-(2,2,2-trifluoroethyl)indole-2,4-diamine;formamide;propane |
|---|---|
| PubChem CID | 157047401 |
| Molecular Formula | C20H31F4N5O |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 4-N-(3-fluoro-1-methylpiperidin-4-yl)-1-(2,2,2-trifluoroethyl)indole-2,4-diamine;formamide;propane |
| SMILES | CCC.CN1CCC(Nc2cccc3c2cc(N)n3CC(F)(F)F)C(F)C1.NC=O |
| InChI | InChI=1S/C16H20F4N4.C3H8.CH3NO/c1-23-6-5-13(11(17)8-23)22-12-3-2-4-14-10(12)7-15(21)24(14)9-16(18,19)20;1-3-2;2-1-3/h2-4,7,11,13,22H,5-6,8-9,21H2,1H3;3H2,1-2H3;1H,(H2,2,3) |
| InChIKey | JCVWWPDTHSFZFA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|