C21H26F4N4O2S — CID 157047571
tert-butyl (3S,4R)-4-[[2-carbamothioyl-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]-3-fluoropiperidine-1-carboxylate (PubChem CID 157047571) has the molecular formula C21H26F4N4O2S and a molecular weight of 474.52 g/mol. Its IUPAC name is tert-butyl (3S,4R)-4-[[2-carbamothioyl-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]-3-fluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4R)-4-[[2-carbamothioyl-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]-3-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 157047571 |
| Molecular Formula | C21H26F4N4O2S |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | tert-butyl (3S,4R)-4-[[2-carbamothioyl-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]-3-fluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](Nc2cccc3c2cc(C(N)=S)n3CC(F)(F)F)[C@@H](F)C1 |
| InChI | InChI=1S/C21H26F4N4O2S/c1-20(2,3)31-19(30)28-8-7-15(13(22)10-28)27-14-5-4-6-16-12(14)9-17(18(26)32)29(16)11-21(23,24)25/h4-6,9,13,15,27H,7-8,10-11H2,1-3H3,(H2,26,32)/t13-,15+/m0/s1 |
| InChIKey | FYAFNJCXJNOKCZ-DZGCQCFKSA-N |
| XLogP | 4.60 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|