C29H38F4N4O — CID 177247570
ethane;N-(3-fluoro-1-methylpiperidin-4-yl)-2-[3-[[(3E,5E)-5-methoxyhepta-1,3,5-trien-4-yl]amino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine (PubChem CID 177247570) has the molecular formula C29H38F4N4O and a molecular weight of 534.64 g/mol. Its IUPAC name is ethane;N-(3-fluoro-1-methylpiperidin-4-yl)-2-[3-[[(3E,5E)-5-methoxyhepta-1,3,5-trien-4-yl]amino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine.
| Compound Name | ethane;N-(3-fluoro-1-methylpiperidin-4-yl)-2-[3-[[(3E,5E)-5-methoxyhepta-1,3,5-trien-4-yl]amino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine |
|---|---|
| PubChem CID | 177247570 |
| Molecular Formula | C29H38F4N4O |
| Molecular Weight | 534.64 g/mol |
| Exact Mass | 534.30 |
| IUPAC Name | ethane;N-(3-fluoro-1-methylpiperidin-4-yl)-2-[3-[[(3E,5E)-5-methoxyhepta-1,3,5-trien-4-yl]amino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine |
| SMILES | C=C/C=C(NCC#Cc1cc2c(NC3CCN(C)CC3F)cccc2n1CC(F)(F)F)\C(=C/C)OC.CC |
| InChI | InChI=1S/C27H32F4N4O.C2H6/c1-5-9-24(26(6-2)36-4)32-14-8-10-19-16-20-22(33-23-13-15-34(3)17-21(23)28)11-7-12-25(20)35(19)18-27(29,30)31;1-2/h5-7,9,11-12,16,21,23,32-33H,1,13-15,17-18H2,2-4H3;1-2H3/b24-9+,26-6+; |
| InChIKey | GURUWHYIQWPGFK-MRYQCEBESA-N |
| XLogP | 6.25 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.64 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|