C28H31F3N4O4S — CID 170245981
1-cyclohexyl-3-[2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]urea (PubChem CID 170245981) has the molecular formula C28H31F3N4O4S and a molecular weight of 576.64 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]urea.
| Compound Name | 1-cyclohexyl-3-[2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]urea |
|---|---|
| PubChem CID | 170245981 |
| Molecular Formula | C28H31F3N4O4S |
| Molecular Weight | 576.64 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | 1-cyclohexyl-3-[2-[3-(2-methoxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]urea |
| SMILES | COc1cc(S(C)(=O)=O)ccc1NCC#Cc1cc2c(NC(=O)NC3CCCCC3)cccc2n1CC(F)(F)F |
| InChI | InChI=1S/C28H31F3N4O4S/c1-39-26-17-21(40(2,37)38)13-14-24(26)32-15-7-10-20-16-22-23(34-27(36)33-19-8-4-3-5-9-19)11-6-12-25(22)35(20)18-28(29,30)31/h6,11-14,16-17,19,32H,3-5,8-9,15,18H2,1-2H3,(H2,33,34,36) |
| InChIKey | KQROXVPLANPKGF-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 101.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.64 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|