C26H28F3N5O3S — CID 170381118
N-(2-tert-butylpyrimidin-5-yl)-3-[4-[(1,1-dioxothian-4-yl)amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynamide (PubChem CID 170381118) has the molecular formula C26H28F3N5O3S and a molecular weight of 547.60 g/mol. Its IUPAC name is N-(2-tert-butylpyrimidin-5-yl)-3-[4-[(1,1-dioxothian-4-yl)amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynamide.
| Compound Name | N-(2-tert-butylpyrimidin-5-yl)-3-[4-[(1,1-dioxothian-4-yl)amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynamide |
|---|---|
| PubChem CID | 170381118 |
| Molecular Formula | C26H28F3N5O3S |
| Molecular Weight | 547.60 g/mol |
| Exact Mass | 547.19 |
| IUPAC Name | N-(2-tert-butylpyrimidin-5-yl)-3-[4-[(1,1-dioxothian-4-yl)amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynamide |
| SMILES | CC(C)(C)c1ncc(NC(=O)C#Cc2cc3c(NC4CCS(=O)(=O)CC4)cccc3n2CC(F)(F)F)cn1 |
| InChI | InChI=1S/C26H28F3N5O3S/c1-25(2,3)24-30-14-18(15-31-24)33-23(35)8-7-19-13-20-21(32-17-9-11-38(36,37)12-10-17)5-4-6-22(20)34(19)16-26(27,28)29/h4-6,13-15,17,32H,9-12,16H2,1-3H3,(H,33,35) |
| InChIKey | ORRCYFLASOONPY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.60 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|