C27H29F3N4OS — CID 178034646
1-[4-[[2-[3-(4-sulfanylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]propan-2-one (PubChem CID 178034646) has the molecular formula C27H29F3N4OS and a molecular weight of 514.62 g/mol. Its IUPAC name is 1-[4-[[2-[3-(4-sulfanylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]propan-2-one.
| Compound Name | 1-[4-[[2-[3-(4-sulfanylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]propan-2-one |
|---|---|
| PubChem CID | 178034646 |
| Molecular Formula | C27H29F3N4OS |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | 1-[4-[[2-[3-(4-sulfanylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]propan-2-one |
| SMILES | CC(=O)CN1CCC(Nc2cccc3c2cc(C#CCNc2ccc(S)cc2)n3CC(F)(F)F)CC1 |
| InChI | InChI=1S/C27H29F3N4OS/c1-19(35)17-33-14-11-21(12-15-33)32-25-5-2-6-26-24(25)16-22(34(26)18-27(28,29)30)4-3-13-31-20-7-9-23(36)10-8-20/h2,5-10,16,21,31-32,36H,11-15,17-18H2,1H3 |
| InChIKey | OZENGVDTDNPLAG-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 49.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|