C20H25F3N4 — CID 130361852
2-[3-(methylamino)prop-1-ynyl]-N-(1-methylpiperidin-4-yl)-1-(2,2,2-trifluoroethyl)indol-4-amine (PubChem CID 130361852) has the molecular formula C20H25F3N4 and a molecular weight of 378.44 g/mol. Its IUPAC name is 2-[3-(methylamino)prop-1-ynyl]-N-(1-methylpiperidin-4-yl)-1-(2,2,2-trifluoroethyl)indol-4-amine.
| Compound Name | 2-[3-(methylamino)prop-1-ynyl]-N-(1-methylpiperidin-4-yl)-1-(2,2,2-trifluoroethyl)indol-4-amine |
|---|---|
| PubChem CID | 130361852 |
| Molecular Formula | C20H25F3N4 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 2-[3-(methylamino)prop-1-ynyl]-N-(1-methylpiperidin-4-yl)-1-(2,2,2-trifluoroethyl)indol-4-amine |
| SMILES | CNCC#Cc1cc2c(NC3CCN(C)CC3)cccc2n1CC(F)(F)F |
| InChI | InChI=1S/C20H25F3N4/c1-24-10-4-5-16-13-17-18(25-15-8-11-26(2)12-9-15)6-3-7-19(17)27(16)14-20(21,22)23/h3,6-7,13,15,24-25H,8-12,14H2,1-2H3 |
| InChIKey | RXCRDKAKKRWGDP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 32.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|