C29H37FN4O2S — CID 165372885
2-[3-(4-ethylsulfonylanilino)prop-1-ynyl]-1-(2-fluoro-2-methylpropyl)-N-(1-methylpiperidin-4-yl)indol-4-amine (PubChem CID 165372885) has the molecular formula C29H37FN4O2S and a molecular weight of 524.71 g/mol. Its IUPAC name is 2-[3-(4-ethylsulfonylanilino)prop-1-ynyl]-1-(2-fluoro-2-methylpropyl)-N-(1-methylpiperidin-4-yl)indol-4-amine.
| Compound Name | 2-[3-(4-ethylsulfonylanilino)prop-1-ynyl]-1-(2-fluoro-2-methylpropyl)-N-(1-methylpiperidin-4-yl)indol-4-amine |
|---|---|
| PubChem CID | 165372885 |
| Molecular Formula | C29H37FN4O2S |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | 2-[3-(4-ethylsulfonylanilino)prop-1-ynyl]-1-(2-fluoro-2-methylpropyl)-N-(1-methylpiperidin-4-yl)indol-4-amine |
| SMILES | CCS(=O)(=O)c1ccc(NCC#Cc2cc3c(NC4CCN(C)CC4)cccc3n2CC(C)(C)F)cc1 |
| InChI | InChI=1S/C29H37FN4O2S/c1-5-37(35,36)25-13-11-22(12-14-25)31-17-7-8-24-20-26-27(32-23-15-18-33(4)19-16-23)9-6-10-28(26)34(24)21-29(2,3)30/h6,9-14,20,23,31-32H,5,15-19,21H2,1-4H3 |
| InChIKey | ZIHMSBLHEBFTPC-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|