C26H29F3N4O — CID 130337919
2-[3-(4-methoxyanilino)prop-1-ynyl]-N-(1-methylpiperidin-4-yl)-1-(2,2,2-trifluoroethyl)indol-4-amine (PubChem CID 130337919) has the molecular formula C26H29F3N4O and a molecular weight of 470.54 g/mol. Its IUPAC name is 2-[3-(4-methoxyanilino)prop-1-ynyl]-N-(1-methylpiperidin-4-yl)-1-(2,2,2-trifluoroethyl)indol-4-amine.
| Compound Name | 2-[3-(4-methoxyanilino)prop-1-ynyl]-N-(1-methylpiperidin-4-yl)-1-(2,2,2-trifluoroethyl)indol-4-amine |
|---|---|
| PubChem CID | 130337919 |
| Molecular Formula | C26H29F3N4O |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | 2-[3-(4-methoxyanilino)prop-1-ynyl]-N-(1-methylpiperidin-4-yl)-1-(2,2,2-trifluoroethyl)indol-4-amine |
| SMILES | COc1ccc(NCC#Cc2cc3c(NC4CCN(C)CC4)cccc3n2CC(F)(F)F)cc1 |
| InChI | InChI=1S/C26H29F3N4O/c1-32-15-12-20(13-16-32)31-24-6-3-7-25-23(24)17-21(33(25)18-26(27,28)29)5-4-14-30-19-8-10-22(34-2)11-9-19/h3,6-11,17,20,30-31H,12-16,18H2,1-2H3 |
| InChIKey | RHSSNGRSYRXZLA-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|