C31H39F3N6OS — CID 145356346
2-[3-[2-methoxy-4-(4-methylpiperazin-1-yl)sulfanylanilino]prop-1-ynyl]-N-(1-methylpiperidin-4-yl)-1-(2,2,2-trifluoroethyl)indol-4-amine (PubChem CID 145356346) has the molecular formula C31H39F3N6OS and a molecular weight of 600.76 g/mol. Its IUPAC name is 2-[3-[2-methoxy-4-(4-methylpiperazin-1-yl)sulfanylanilino]prop-1-ynyl]-N-(1-methylpiperidin-4-yl)-1-(2,2,2-trifluoroethyl)indol-4-amine.
| Compound Name | 2-[3-[2-methoxy-4-(4-methylpiperazin-1-yl)sulfanylanilino]prop-1-ynyl]-N-(1-methylpiperidin-4-yl)-1-(2,2,2-trifluoroethyl)indol-4-amine |
|---|---|
| PubChem CID | 145356346 |
| Molecular Formula | C31H39F3N6OS |
| Molecular Weight | 600.76 g/mol |
| Exact Mass | 600.29 |
| IUPAC Name | 2-[3-[2-methoxy-4-(4-methylpiperazin-1-yl)sulfanylanilino]prop-1-ynyl]-N-(1-methylpiperidin-4-yl)-1-(2,2,2-trifluoroethyl)indol-4-amine |
| SMILES | COc1cc(SN2CCN(C)CC2)ccc1NCC#Cc1cc2c(NC3CCN(C)CC3)cccc2n1CC(F)(F)F |
| InChI | InChI=1S/C31H39F3N6OS/c1-37-14-11-23(12-15-37)36-27-7-4-8-29-26(27)20-24(40(29)22-31(32,33)34)6-5-13-35-28-10-9-25(21-30(28)41-3)42-39-18-16-38(2)17-19-39/h4,7-10,20-21,23,35-36H,11-19,22H2,1-3H3 |
| InChIKey | DYFGMAHKPQKTLW-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.76 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|