C36H51F3N6O4S — CID 171638149
2-[3-[4-(dimethylaminosulfanyl)-2-methoxyanilino]prop-1-ynyl]-N-[1-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethyl]piperidin-4-yl]-1-(2,2,2-trifluoroethyl)indol-4-amine (PubChem CID 171638149) has the molecular formula C36H51F3N6O4S and a molecular weight of 720.90 g/mol. Its IUPAC name is 2-[3-[4-(dimethylaminosulfanyl)-2-methoxyanilino]prop-1-ynyl]-N-[1-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethyl]piperidin-4-yl]-1-(2,2,2-trifluoroethyl)indol-4-amine.
| Compound Name | 2-[3-[4-(dimethylaminosulfanyl)-2-methoxyanilino]prop-1-ynyl]-N-[1-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethyl]piperidin-4-yl]-1-(2,2,2-trifluoroethyl)indol-4-amine |
|---|---|
| PubChem CID | 171638149 |
| Molecular Formula | C36H51F3N6O4S |
| Molecular Weight | 720.90 g/mol |
| Exact Mass | 720.36 |
| IUPAC Name | 2-[3-[4-(dimethylaminosulfanyl)-2-methoxyanilino]prop-1-ynyl]-N-[1-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethyl]piperidin-4-yl]-1-(2,2,2-trifluoroethyl)indol-4-amine |
| SMILES | CNCCOCCOCCOCCN1CCC(Nc2cccc3c2cc(C#CCNc2ccc(SN(C)C)cc2OC)n3CC(F)(F)F)CC1 |
| InChI | InChI=1S/C36H51F3N6O4S/c1-40-15-19-47-21-23-49-24-22-48-20-18-44-16-12-28(13-17-44)42-32-8-5-9-34-31(32)25-29(45(34)27-36(37,38)39)7-6-14-41-33-11-10-30(50-43(2)3)26-35(33)46-4/h5,8-11,25-26,28,40-42H,12-24,27H2,1-4H3 |
| InChIKey | YVUJJAYDRSSBHW-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.90 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|