C29H36F3N5O2S — CID 156712840
N-[1-(2-methoxyethyl)piperidin-4-yl]-2-[3-[2-methoxy-4-(methylaminosulfanyl)anilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine (PubChem CID 156712840) has the molecular formula C29H36F3N5O2S and a molecular weight of 575.70 g/mol. Its IUPAC name is N-[1-(2-methoxyethyl)piperidin-4-yl]-2-[3-[2-methoxy-4-(methylaminosulfanyl)anilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine.
| Compound Name | N-[1-(2-methoxyethyl)piperidin-4-yl]-2-[3-[2-methoxy-4-(methylaminosulfanyl)anilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine |
|---|---|
| PubChem CID | 156712840 |
| Molecular Formula | C29H36F3N5O2S |
| Molecular Weight | 575.70 g/mol |
| Exact Mass | 575.25 |
| IUPAC Name | N-[1-(2-methoxyethyl)piperidin-4-yl]-2-[3-[2-methoxy-4-(methylaminosulfanyl)anilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine |
| SMILES | CNSc1ccc(NCC#Cc2cc3c(NC4CCN(CCOC)CC4)cccc3n2CC(F)(F)F)c(OC)c1 |
| InChI | InChI=1S/C29H36F3N5O2S/c1-33-40-23-9-10-26(28(19-23)39-3)34-13-5-6-22-18-24-25(7-4-8-27(24)37(22)20-29(30,31)32)35-21-11-14-36(15-12-21)16-17-38-2/h4,7-10,18-19,21,33-35H,11-17,20H2,1-3H3 |
| InChIKey | ZYGYWVNUPVQOHI-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.70 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|