C27H30F4N4OS — CID 156712772
N-cyclohexyl-2-[3-[2-(fluoromethoxy)-4-(methylaminosulfanyl)anilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine (PubChem CID 156712772) has the molecular formula C27H30F4N4OS and a molecular weight of 534.62 g/mol. Its IUPAC name is N-cyclohexyl-2-[3-[2-(fluoromethoxy)-4-(methylaminosulfanyl)anilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine.
| Compound Name | N-cyclohexyl-2-[3-[2-(fluoromethoxy)-4-(methylaminosulfanyl)anilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine |
|---|---|
| PubChem CID | 156712772 |
| Molecular Formula | C27H30F4N4OS |
| Molecular Weight | 534.62 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | N-cyclohexyl-2-[3-[2-(fluoromethoxy)-4-(methylaminosulfanyl)anilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine |
| SMILES | CNSc1ccc(NCC#Cc2cc3c(NC4CCCCC4)cccc3n2CC(F)(F)F)c(OCF)c1 |
| InChI | InChI=1S/C27H30F4N4OS/c1-32-37-21-12-13-24(26(16-21)36-18-28)33-14-6-9-20-15-22-23(34-19-7-3-2-4-8-19)10-5-11-25(22)35(20)17-27(29,30)31/h5,10-13,15-16,19,32-34H,2-4,7-8,14,17-18H2,1H3 |
| InChIKey | SCYJFGNUFKIJIR-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 50.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.62 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|