C35H48F3N5O2S — CID 156712127
2-[3-[4-(cyclohexylamino)-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]-5-(methylaminosulfanyl)phenol;ethane;2-oxa-7-azaspiro[3.5]nonane (PubChem CID 156712127) has the molecular formula C35H48F3N5O2S and a molecular weight of 659.86 g/mol. Its IUPAC name is 2-[3-[4-(cyclohexylamino)-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]-5-(methylaminosulfanyl)phenol;ethane;2-oxa-7-azaspiro[3.5]nonane.
| Compound Name | 2-[3-[4-(cyclohexylamino)-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]-5-(methylaminosulfanyl)phenol;ethane;2-oxa-7-azaspiro[3.5]nonane |
|---|---|
| PubChem CID | 156712127 |
| Molecular Formula | C35H48F3N5O2S |
| Molecular Weight | 659.86 g/mol |
| Exact Mass | 659.35 |
| IUPAC Name | 2-[3-[4-(cyclohexylamino)-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]-5-(methylaminosulfanyl)phenol;ethane;2-oxa-7-azaspiro[3.5]nonane |
| SMILES | C1CC2(CCN1)COC2.CC.CNSc1ccc(NCC#Cc2cc3c(NC4CCCCC4)cccc3n2CC(F)(F)F)c(O)c1 |
| InChI | InChI=1S/C26H29F3N4OS.C7H13NO.C2H6/c1-30-35-20-12-13-23(25(34)16-20)31-14-6-9-19-15-21-22(32-18-7-3-2-4-8-18)10-5-11-24(21)33(19)17-26(27,28)29;1-3-8-4-2-7(1)5-9-6-7;1-2/h5,10-13,15-16,18,30-32,34H,2-4,7-8,14,17H2,1H3;8H,1-6H2;1-2H3 |
| InChIKey | URDZBFREEHYANO-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.86 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|