C33H39F3N4O2S — CID 156712710
5-methylsulfanyl-2-[3-[4-[[4-(2-oxa-7-azaspiro[3.5]nonan-7-yl)cyclohexyl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]phenol (PubChem CID 156712710) has the molecular formula C33H39F3N4O2S and a molecular weight of 612.76 g/mol. Its IUPAC name is 5-methylsulfanyl-2-[3-[4-[[4-(2-oxa-7-azaspiro[3.5]nonan-7-yl)cyclohexyl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]phenol.
| Compound Name | 5-methylsulfanyl-2-[3-[4-[[4-(2-oxa-7-azaspiro[3.5]nonan-7-yl)cyclohexyl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]phenol |
|---|---|
| PubChem CID | 156712710 |
| Molecular Formula | C33H39F3N4O2S |
| Molecular Weight | 612.76 g/mol |
| Exact Mass | 612.27 |
| IUPAC Name | 5-methylsulfanyl-2-[3-[4-[[4-(2-oxa-7-azaspiro[3.5]nonan-7-yl)cyclohexyl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]phenol |
| SMILES | CSc1ccc(NCC#Cc2cc3c(NC4CCC(N5CCC6(CC5)COC6)CC4)cccc3n2CC(F)(F)F)c(O)c1 |
| InChI | InChI=1S/C33H39F3N4O2S/c1-43-26-11-12-29(31(41)19-26)37-15-3-4-25-18-27-28(5-2-6-30(27)40(25)20-33(34,35)36)38-23-7-9-24(10-8-23)39-16-13-32(14-17-39)21-42-22-32/h2,5-6,11-12,18-19,23-24,37-38,41H,7-10,13-17,20-22H2,1H3 |
| InChIKey | YSGUBFYACDWLDW-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.76 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|