C27H29F3N4O5S — CID 156712687
2-hydroxy-1-[4-[[2-[3-(2-hydroxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]ethanone (PubChem CID 156712687) has the molecular formula C27H29F3N4O5S and a molecular weight of 578.61 g/mol. Its IUPAC name is 2-hydroxy-1-[4-[[2-[3-(2-hydroxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]ethanone.
| Compound Name | 2-hydroxy-1-[4-[[2-[3-(2-hydroxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 156712687 |
| Molecular Formula | C27H29F3N4O5S |
| Molecular Weight | 578.61 g/mol |
| Exact Mass | 578.18 |
| IUPAC Name | 2-hydroxy-1-[4-[[2-[3-(2-hydroxy-4-methylsulfonylanilino)prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-yl]amino]piperidin-1-yl]ethanone |
| SMILES | CS(=O)(=O)c1ccc(NCC#Cc2cc3c(NC4CCN(C(=O)CO)CC4)cccc3n2CC(F)(F)F)c(O)c1 |
| InChI | InChI=1S/C27H29F3N4O5S/c1-40(38,39)20-7-8-23(25(36)15-20)31-11-3-4-19-14-21-22(5-2-6-24(21)34(19)17-27(28,29)30)32-18-9-12-33(13-10-18)26(37)16-35/h2,5-8,14-15,18,31-32,35-36H,9-13,16-17H2,1H3 |
| InChIKey | JUVRWDMZUXMAKN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 123.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.61 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|