C31H42F3N5OS — CID 156713052
N-cyclohexyl-2-[3-[2-methoxy-4-(methylaminosulfanyl)anilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine;N-ethylethanamine (PubChem CID 156713052) has the molecular formula C31H42F3N5OS and a molecular weight of 589.77 g/mol. Its IUPAC name is N-cyclohexyl-2-[3-[2-methoxy-4-(methylaminosulfanyl)anilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine;N-ethylethanamine.
| Compound Name | N-cyclohexyl-2-[3-[2-methoxy-4-(methylaminosulfanyl)anilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine;N-ethylethanamine |
|---|---|
| PubChem CID | 156713052 |
| Molecular Formula | C31H42F3N5OS |
| Molecular Weight | 589.77 g/mol |
| Exact Mass | 589.31 |
| IUPAC Name | N-cyclohexyl-2-[3-[2-methoxy-4-(methylaminosulfanyl)anilino]prop-1-ynyl]-1-(2,2,2-trifluoroethyl)indol-4-amine;N-ethylethanamine |
| SMILES | CCNCC.CNSc1ccc(NCC#Cc2cc3c(NC4CCCCC4)cccc3n2CC(F)(F)F)c(OC)c1 |
| InChI | InChI=1S/C27H31F3N4OS.C4H11N/c1-31-36-21-13-14-24(26(17-21)35-2)32-15-7-10-20-16-22-23(33-19-8-4-3-5-9-19)11-6-12-25(22)34(20)18-27(28,29)30;1-3-5-4-2/h6,11-14,16-17,19,31-33H,3-5,8-9,15,18H2,1-2H3;5H,3-4H2,1-2H3 |
| InChIKey | FMQQZTIRYXBHGV-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 62.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.77 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|